C23H25F3N2O4S — CID 53323869
[5-methylsulfonyl-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxyphenyl]-(5-pyrrolidin-1-yl-1,3-dihydroisoindol-2-yl)methanone (PubChem CID 53323869) has the molecular formula C23H25F3N2O4S and a molecular weight of 482.52 g/mol. Its IUPAC name is [5-methylsulfonyl-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxyphenyl]-(5-pyrrolidin-1-yl-1,3-dihydroisoindol-2-yl)methanone.
| Compound Name | [5-methylsulfonyl-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxyphenyl]-(5-pyrrolidin-1-yl-1,3-dihydroisoindol-2-yl)methanone |
|---|---|
| PubChem CID | 53323869 |
| Molecular Formula | C23H25F3N2O4S |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | [5-methylsulfonyl-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxyphenyl]-(5-pyrrolidin-1-yl-1,3-dihydroisoindol-2-yl)methanone |
| SMILES | C[C@H](Oc1ccc(S(C)(=O)=O)cc1C(=O)N1Cc2ccc(N3CCCC3)cc2C1)C(F)(F)F |
| InChI | InChI=1S/C23H25F3N2O4S/c1-15(23(24,25)26)32-21-8-7-19(33(2,30)31)12-20(21)22(29)28-13-16-5-6-18(11-17(16)14-28)27-9-3-4-10-27/h5-8,11-12,15H,3-4,9-10,13-14H2,1-2H3/t15-/m0/s1 |
| InChIKey | GTRGRYKYZLBMTL-HNNXBMFYSA-N |
| XLogP | 4.18 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|