C26H29ClN6O2 — CID 53323941
N-butyl-2-[[5-chloro-2-[(1-methyl-2-oxo-4,5-dihydro-3H-1-benzazepin-7-yl)amino]pyrimidin-4-yl]amino]benzamide (PubChem CID 53323941) has the molecular formula C26H29ClN6O2 and a molecular weight of 493.01 g/mol. Its IUPAC name is N-butyl-2-[[5-chloro-2-[(1-methyl-2-oxo-4,5-dihydro-3H-1-benzazepin-7-yl)amino]pyrimidin-4-yl]amino]benzamide.
| Compound Name | N-butyl-2-[[5-chloro-2-[(1-methyl-2-oxo-4,5-dihydro-3H-1-benzazepin-7-yl)amino]pyrimidin-4-yl]amino]benzamide |
|---|---|
| PubChem CID | 53323941 |
| Molecular Formula | C26H29ClN6O2 |
| Molecular Weight | 493.01 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | N-butyl-2-[[5-chloro-2-[(1-methyl-2-oxo-4,5-dihydro-3H-1-benzazepin-7-yl)amino]pyrimidin-4-yl]amino]benzamide |
| SMILES | CCCCNC(=O)c1ccccc1Nc1nc(Nc2ccc3c(c2)CCCC(=O)N3C)ncc1Cl |
| InChI | InChI=1S/C26H29ClN6O2/c1-3-4-14-28-25(35)19-9-5-6-10-21(19)31-24-20(27)16-29-26(32-24)30-18-12-13-22-17(15-18)8-7-11-23(34)33(22)2/h5-6,9-10,12-13,15-16H,3-4,7-8,11,14H2,1-2H3,(H,28,35)(H2,29,30,31,32) |
| InChIKey | LNDWTKJDTCDSMV-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.01 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|