C21H23F2NO — CID 53323992
1-[(3,4-difluorophenyl)methyl]-6-ethoxy-2,2,4-trimethylquinoline (PubChem CID 53323992) has the molecular formula C21H23F2NO and a molecular weight of 343.42 g/mol. Its IUPAC name is 1-[(3,4-difluorophenyl)methyl]-6-ethoxy-2,2,4-trimethylquinoline.
| Compound Name | 1-[(3,4-difluorophenyl)methyl]-6-ethoxy-2,2,4-trimethylquinoline |
|---|---|
| PubChem CID | 53323992 |
| Molecular Formula | C21H23F2NO |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 1-[(3,4-difluorophenyl)methyl]-6-ethoxy-2,2,4-trimethylquinoline |
| SMILES | CCOc1ccc2c(c1)C(C)=CC(C)(C)N2Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C21H23F2NO/c1-5-25-16-7-9-20-17(11-16)14(2)12-21(3,4)24(20)13-15-6-8-18(22)19(23)10-15/h6-12H,5,13H2,1-4H3 |
| InChIKey | SNYHHDUHHKZSAU-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|