About (Z)-N-(2,3-dihydroxypropyl)octadec-9-enamide
(Z)-N-(2,3-dihydroxypropyl)octadec-9-enamide (PubChem CID 53324037) has the molecular formula C21H41NO3
and a molecular weight of 355.56 g/mol. Its IUPAC name is (Z)-N-(2,3-dihydroxypropyl)octadec-9-enamide.
Molecular Properties
| Compound Name | (Z)-N-(2,3-dihydroxypropyl)octadec-9-enamide |
| PubChem CID | 53324037 |
| Molecular Formula | C21H41NO3 |
| Molecular Weight | 355.56 g/mol |
| Exact Mass | 355.31 |
| IUPAC Name | (Z)-N-(2,3-dihydroxypropyl)octadec-9-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NCC(O)CO |
| InChI | InChI=1S/C21H41NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(25)22-18-20(24)19-23/h9-10,20,23-24H,2-8,11-19H2,1H3,(H,22,25)/b10-9- |
| InChIKey | PPAJAKNTNIOXSS-KTKRTIGZSA-N |
| XLogP | 4.49 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.56 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-(2,3-dihydroxypropyl)octadec-9-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-(2,3-dihydroxypropyl)octadec-9-enamide?
The IUPAC name of (Z)-N-(2,3-dihydroxypropyl)octadec-9-enamide (CID 53324037) is (Z)-N-(2,3-dihydroxypropyl)octadec-9-enamide.
What is the SMILES notation for (Z)-N-(2,3-dihydroxypropyl)octadec-9-enamide?
The canonical SMILES for (Z)-N-(2,3-dihydroxypropyl)octadec-9-enamide is CCCCCCCC/C=C\CCCCCCCC(=O)NCC(O)CO.
What is the InChIKey of (Z)-N-(2,3-dihydroxypropyl)octadec-9-enamide?
The InChIKey is PPAJAKNTNIOXSS-KTKRTIGZSA-N. The full InChI is InChI=1S/C21H41NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(25)22-18-20(24)19-23/h9-10,20,23-24H,2-8,11-19H2,1H3,(H,22,25)/b10-9-.
What are the key properties of (Z)-N-(2,3-dihydroxypropyl)octadec-9-enamide?
(Z)-N-(2,3-dihydroxypropyl)octadec-9-enamide has a molecular weight of 355.56 g/mol, XLogP of 4.49, 18 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-(2,3-dihydroxypropyl)octadec-9-enamide is sourced from PubChem (CID 53324037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).