C24H37NO2 — CID 53324040
(4Z,7Z,10Z,12Z,15Z,18Z)-N-[(2R)-1-hydroxypropan-2-yl]henicosa-4,7,10,12,15,18-hexaenamide (PubChem CID 53324040) has the molecular formula C24H37NO2 and a molecular weight of 371.57 g/mol. Its IUPAC name is (4Z,7Z,10Z,12Z,15Z,18Z)-N-[(2R)-1-hydroxypropan-2-yl]henicosa-4,7,10,12,15,18-hexaenamide.
| Compound Name | (4Z,7Z,10Z,12Z,15Z,18Z)-N-[(2R)-1-hydroxypropan-2-yl]henicosa-4,7,10,12,15,18-hexaenamide |
|---|---|
| PubChem CID | 53324040 |
| Molecular Formula | C24H37NO2 |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.28 |
| IUPAC Name | (4Z,7Z,10Z,12Z,15Z,18Z)-N-[(2R)-1-hydroxypropan-2-yl]henicosa-4,7,10,12,15,18-hexaenamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C=C/C/C=C\C/C=C\CCC(=O)N[C@H](C)CO |
| InChI | InChI=1S/C24H37NO2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-24(27)25-23(2)22-26/h4-5,7-8,10-13,15-16,18-19,23,26H,3,6,9,14,17,20-22H2,1-2H3,(H,25,27)/b5-4-,8-7-,11-10-,13-12-,16-15-,19-18-/t23-/m1/s1 |
| InChIKey | MNEVPRCUHDRUJY-YTFNXNGVSA-N |
| XLogP | 5.57 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|