C29H36N2O3 — CID 53324125
(1R,2R,9S,17S)-4,5-bis(phenylmethoxy)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one (PubChem CID 53324125) has the molecular formula C29H36N2O3 and a molecular weight of 460.62 g/mol. Its IUPAC name is (1R,2R,9S,17S)-4,5-bis(phenylmethoxy)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one.
| Compound Name | (1R,2R,9S,17S)-4,5-bis(phenylmethoxy)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one |
|---|---|
| PubChem CID | 53324125 |
| Molecular Formula | C29H36N2O3 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | (1R,2R,9S,17S)-4,5-bis(phenylmethoxy)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one |
| SMILES | O=C1C(OCc2ccccc2)C(OCc2ccccc2)C[C@@H]2[C@H]3CCCN4CCC[C@@H](CN12)[C@@H]34 |
| InChI | InChI=1S/C29H36N2O3/c32-29-28(34-20-22-11-5-2-6-12-22)26(33-19-21-9-3-1-4-10-21)17-25-24-14-8-16-30-15-7-13-23(27(24)30)18-31(25)29/h1-6,9-12,23-28H,7-8,13-20H2/t23-,24+,25+,26?,27-,28?/m0/s1 |
| InChIKey | AHHJEWZLXMNTAE-VBJCNYAASA-N |
| XLogP | 4.26 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |