C13H18O5S — CID 53324146
(2R,3S,4S,5S,6R)-2-benzylsulfanyl-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 53324146) has the molecular formula C13H18O5S and a molecular weight of 286.35 g/mol. Its IUPAC name is (2R,3S,4S,5S,6R)-2-benzylsulfanyl-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5S,6R)-2-benzylsulfanyl-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 53324146 |
| Molecular Formula | C13H18O5S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | (2R,3S,4S,5S,6R)-2-benzylsulfanyl-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@H](SCc2ccccc2)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H18O5S/c14-6-9-10(15)11(16)12(17)13(18-9)19-7-8-4-2-1-3-5-8/h1-5,9-17H,6-7H2/t9-,10-,11+,12+,13-/m1/s1 |
| InChIKey | DFHLGNPEEWMYFO-NAWOPXAZSA-N |
| XLogP | -0.28 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |