C16H18O4 — CID 53324237
(2R)-7-methoxy-2,3,3-trimethyl-3a,9a-dihydro-2H-benzo[f][1]benzofuran-4,9-dione (PubChem CID 53324237) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is (2R)-7-methoxy-2,3,3-trimethyl-3a,9a-dihydro-2H-benzo[f][1]benzofuran-4,9-dione.
| Compound Name | (2R)-7-methoxy-2,3,3-trimethyl-3a,9a-dihydro-2H-benzo[f][1]benzofuran-4,9-dione |
|---|---|
| PubChem CID | 53324237 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | (2R)-7-methoxy-2,3,3-trimethyl-3a,9a-dihydro-2H-benzo[f][1]benzofuran-4,9-dione |
| SMILES | COc1ccc2c(c1)C(=O)C1O[C@H](C)C(C)(C)C1C2=O |
| InChI | InChI=1S/C16H18O4/c1-8-16(2,3)12-13(17)10-6-5-9(19-4)7-11(10)14(18)15(12)20-8/h5-8,12,15H,1-4H3/t8-,12?,15?/m1/s1 |
| InChIKey | AWHRZPYMXDYJBL-HOKWILEXSA-N |
| XLogP | 2.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|