C27H31N3O6 — CID 53324426
N-[2-ethoxy-4-(2-morpholin-4-yl-4-oxochromen-8-yl)phenyl]-2-morpholin-4-ylacetamide (PubChem CID 53324426) has the molecular formula C27H31N3O6 and a molecular weight of 493.56 g/mol. Its IUPAC name is N-[2-ethoxy-4-(2-morpholin-4-yl-4-oxochromen-8-yl)phenyl]-2-morpholin-4-ylacetamide.
| Compound Name | N-[2-ethoxy-4-(2-morpholin-4-yl-4-oxochromen-8-yl)phenyl]-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 53324426 |
| Molecular Formula | C27H31N3O6 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | N-[2-ethoxy-4-(2-morpholin-4-yl-4-oxochromen-8-yl)phenyl]-2-morpholin-4-ylacetamide |
| SMILES | CCOc1cc(-c2cccc3c(=O)cc(N4CCOCC4)oc23)ccc1NC(=O)CN1CCOCC1 |
| InChI | InChI=1S/C27H31N3O6/c1-2-35-24-16-19(6-7-22(24)28-25(32)18-29-8-12-33-13-9-29)20-4-3-5-21-23(31)17-26(36-27(20)21)30-10-14-34-15-11-30/h3-7,16-17H,2,8-15,18H2,1H3,(H,28,32) |
| InChIKey | RMKWCFQVLOKCHU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 93.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |