About 4-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-1H-indazol-3-amine;hydrochloride
4-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-1H-indazol-3-amine;hydrochloride (PubChem CID 53324489) has the molecular formula C10H11Cl2N5
and a molecular weight of 272.14 g/mol. Its IUPAC name is 4-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-1H-indazol-3-amine;hydrochloride.
Molecular Properties
| Compound Name | 4-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-1H-indazol-3-amine;hydrochloride |
| PubChem CID | 53324489 |
| Molecular Formula | C10H11Cl2N5 |
| Molecular Weight | 272.14 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 4-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-1H-indazol-3-amine;hydrochloride |
| SMILES | Cl.Clc1cccc2[nH]nc(NC3=NCCN3)c12 |
| InChI | InChI=1S/C10H10ClN5.ClH/c11-6-2-1-3-7-8(6)9(16-15-7)14-10-12-4-5-13-10;/h1-3H,4-5H2,(H3,12,13,14,15,16);1H |
| InChIKey | XDWACKVIRRKDJY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.14 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-1H-indazol-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-1H-indazol-3-amine;hydrochloride?
The IUPAC name of 4-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-1H-indazol-3-amine;hydrochloride (CID 53324489) is 4-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-1H-indazol-3-amine;hydrochloride.
What is the SMILES notation for 4-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-1H-indazol-3-amine;hydrochloride?
The canonical SMILES for 4-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-1H-indazol-3-amine;hydrochloride is Cl.Clc1cccc2[nH]nc(NC3=NCCN3)c12.
What is the InChIKey of 4-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-1H-indazol-3-amine;hydrochloride?
The InChIKey is XDWACKVIRRKDJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClN5.ClH/c11-6-2-1-3-7-8(6)9(16-15-7)14-10-12-4-5-13-10;/h1-3H,4-5H2,(H3,12,13,14,15,16);1H.
What are the key properties of 4-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-1H-indazol-3-amine;hydrochloride?
4-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-1H-indazol-3-amine;hydrochloride has a molecular weight of 272.14 g/mol, XLogP of 2.01, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-1H-indazol-3-amine;hydrochloride is sourced from PubChem (CID 53324489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).