About 5-(6-chloro-1,3-dioxobenzo[de]isoquinolin-2-yl)pentyl selenocyanate
5-(6-chloro-1,3-dioxobenzo[de]isoquinolin-2-yl)pentyl selenocyanate (PubChem CID 53324516) has the molecular formula C18H15ClN2O2Se
and a molecular weight of 405.74 g/mol. Its IUPAC name is 5-(6-chloro-1,3-dioxobenzo[de]isoquinolin-2-yl)pentyl selenocyanate.
Molecular Properties
| Compound Name | 5-(6-chloro-1,3-dioxobenzo[de]isoquinolin-2-yl)pentyl selenocyanate |
| PubChem CID | 53324516 |
| Molecular Formula | C18H15ClN2O2Se |
| Molecular Weight | 405.74 g/mol |
| Exact Mass | 406.00 |
| IUPAC Name | 5-(6-chloro-1,3-dioxobenzo[de]isoquinolin-2-yl)pentyl selenocyanate |
| SMILES | N#C[Se]CCCCCN1C(=O)c2cccc3c(Cl)ccc(c23)C1=O |
| InChI | InChI=1S/C18H15ClN2O2Se/c19-15-8-7-14-16-12(15)5-4-6-13(16)17(22)21(18(14)23)9-2-1-3-10-24-11-20/h4-8H,1-3,9-10H2 |
| InChIKey | CIFYQIGQBITDRZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.74 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 5-(6-chloro-1,3-dioxobenzo[de]isoquinolin-2-yl)pentyl selenocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(6-chloro-1,3-dioxobenzo[de]isoquinolin-2-yl)pentyl selenocyanate?
The IUPAC name of 5-(6-chloro-1,3-dioxobenzo[de]isoquinolin-2-yl)pentyl selenocyanate (CID 53324516) is 5-(6-chloro-1,3-dioxobenzo[de]isoquinolin-2-yl)pentyl selenocyanate.
What is the SMILES notation for 5-(6-chloro-1,3-dioxobenzo[de]isoquinolin-2-yl)pentyl selenocyanate?
The canonical SMILES for 5-(6-chloro-1,3-dioxobenzo[de]isoquinolin-2-yl)pentyl selenocyanate is N#C[Se]CCCCCN1C(=O)c2cccc3c(Cl)ccc(c23)C1=O.
What is the InChIKey of 5-(6-chloro-1,3-dioxobenzo[de]isoquinolin-2-yl)pentyl selenocyanate?
The InChIKey is CIFYQIGQBITDRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15ClN2O2Se/c19-15-8-7-14-16-12(15)5-4-6-13(16)17(22)21(18(14)23)9-2-1-3-10-24-11-20/h4-8H,1-3,9-10H2.
What are the key properties of 5-(6-chloro-1,3-dioxobenzo[de]isoquinolin-2-yl)pentyl selenocyanate?
5-(6-chloro-1,3-dioxobenzo[de]isoquinolin-2-yl)pentyl selenocyanate has a molecular weight of 405.74 g/mol, XLogP of 3.86, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(6-chloro-1,3-dioxobenzo[de]isoquinolin-2-yl)pentyl selenocyanate is sourced from PubChem (CID 53324516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).