C26H29ClN6O2 — CID 53324590
N-[3-[5-chloro-2-[4-[2-(4-methylpiperazin-1-yl)ethyl]anilino]pyrimidin-4-yl]oxyphenyl]prop-2-enamide (PubChem CID 53324590) has the molecular formula C26H29ClN6O2 and a molecular weight of 493.01 g/mol. Its IUPAC name is N-[3-[5-chloro-2-[4-[2-(4-methylpiperazin-1-yl)ethyl]anilino]pyrimidin-4-yl]oxyphenyl]prop-2-enamide.
| Compound Name | N-[3-[5-chloro-2-[4-[2-(4-methylpiperazin-1-yl)ethyl]anilino]pyrimidin-4-yl]oxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 53324590 |
| Molecular Formula | C26H29ClN6O2 |
| Molecular Weight | 493.01 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | N-[3-[5-chloro-2-[4-[2-(4-methylpiperazin-1-yl)ethyl]anilino]pyrimidin-4-yl]oxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Oc2nc(Nc3ccc(CCN4CCN(C)CC4)cc3)ncc2Cl)c1 |
| InChI | InChI=1S/C26H29ClN6O2/c1-3-24(34)29-21-5-4-6-22(17-21)35-25-23(27)18-28-26(31-25)30-20-9-7-19(8-10-20)11-12-33-15-13-32(2)14-16-33/h3-10,17-18H,1,11-16H2,2H3,(H,29,34)(H,28,30,31) |
| InChIKey | FXIZPLLEWPMMAD-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.01 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|