C15H21N5 — CID 53324629
8-piperidin-1-yl-2,6,7,12-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraene (PubChem CID 53324629) has the molecular formula C15H21N5 and a molecular weight of 271.37 g/mol. Its IUPAC name is 8-piperidin-1-yl-2,6,7,12-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraene.
| Compound Name | 8-piperidin-1-yl-2,6,7,12-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraene |
|---|---|
| PubChem CID | 53324629 |
| Molecular Formula | C15H21N5 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | 8-piperidin-1-yl-2,6,7,12-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraene |
| SMILES | c1cc2nc3c(c(N4CCCCC4)n2n1)CCNCC3 |
| InChI | InChI=1S/C15H21N5/c1-2-10-19(11-3-1)15-12-4-7-16-8-5-13(12)18-14-6-9-17-20(14)15/h6,9,16H,1-5,7-8,10-11H2 |
| InChIKey | UROKAICMVLKJBW-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 45.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |