C42H60O5 — CID 53324713
5-O-[[(4aS,6aR,6aS,6bR,8aR,12aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picen-4a-yl]methyl] 1-O-benzyl pentanedioate (PubChem CID 53324713) has the molecular formula C42H60O5 and a molecular weight of 644.94 g/mol. Its IUPAC name is 5-O-[[(4aS,6aR,6aS,6bR,8aR,12aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picen-4a-yl]methyl] 1-O-benzyl pentanedioate.
| Compound Name | 5-O-[[(4aS,6aR,6aS,6bR,8aR,12aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picen-4a-yl]methyl] 1-O-benzyl pentanedioate |
|---|---|
| PubChem CID | 53324713 |
| Molecular Formula | C42H60O5 |
| Molecular Weight | 644.94 g/mol |
| Exact Mass | 644.44 |
| IUPAC Name | 5-O-[[(4aS,6aR,6aS,6bR,8aR,12aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picen-4a-yl]methyl] 1-O-benzyl pentanedioate |
| SMILES | CC1(C)CC[C@]2(COC(=O)CCCC(=O)OCc3ccccc3)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CCC(=O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1 |
| InChI | InChI=1S/C42H60O5/c1-37(2)22-24-42(28-47-36(45)15-11-14-35(44)46-27-29-12-9-8-10-13-29)25-23-40(6)30(31(42)26-37)16-17-33-39(5)20-19-34(43)38(3,4)32(39)18-21-41(33,40)7/h8-10,12-13,16,31-33H,11,14-15,17-28H2,1-7H3/t31-,32-,33+,39-,40+,41+,42+/m0/s1 |
| InChIKey | XJVVBWHHCGEHOX-SCAKSBNOSA-N |
| XLogP | 9.81 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.94 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|