C9H14N2O5S — CID 53324780
(2S,5R,6R)-6-(azaniumylmethyl)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 53324780) has the molecular formula C9H14N2O5S and a molecular weight of 262.29 g/mol. Its IUPAC name is (2S,5R,6R)-6-(azaniumylmethyl)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | (2S,5R,6R)-6-(azaniumylmethyl)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 53324780 |
| Molecular Formula | C9H14N2O5S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | (2S,5R,6R)-6-(azaniumylmethyl)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(C)[C@H](C(=O)[O-])N2C(=O)[C@@H](C[NH3+])[C@H]2S1(=O)=O |
| InChI | InChI=1S/C9H14N2O5S/c1-9(2)5(8(13)14)11-6(12)4(3-10)7(11)17(9,15)16/h4-5,7H,3,10H2,1-2H3,(H,13,14)/t4-,5+,7-/m1/s1 |
| InChIKey | SLTAHADTEZRHPO-JCGDXUMPSA-N |
| XLogP | -3.66 |
| TPSA | 122.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | -3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |