C10H12F3N2NaO7S2 — CID 53324783
sodium (2S,5R,6R)-3,3-dimethyl-4,4,7-trioxo-6-[(trifluoromethylsulfonylamino)methyl]-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 53324783) has the molecular formula C10H12F3N2NaO7S2 and a molecular weight of 416.33 g/mol. Its IUPAC name is sodium (2S,5R,6R)-3,3-dimethyl-4,4,7-trioxo-6-[(trifluoromethylsulfonylamino)methyl]-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | sodium (2S,5R,6R)-3,3-dimethyl-4,4,7-trioxo-6-[(trifluoromethylsulfonylamino)methyl]-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 53324783 |
| Molecular Formula | C10H12F3N2NaO7S2 |
| Molecular Weight | 416.33 g/mol |
| Exact Mass | 415.99 |
| IUPAC Name | sodium (2S,5R,6R)-3,3-dimethyl-4,4,7-trioxo-6-[(trifluoromethylsulfonylamino)methyl]-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(C)[C@H](C(=O)[O-])N2C(=O)[C@@H](CNS(=O)(=O)C(F)(F)F)[C@H]2S1(=O)=O.[Na+] |
| InChI | InChI=1S/C10H13F3N2O7S2.Na/c1-9(2)5(8(17)18)15-6(16)4(7(15)23(9,19)20)3-14-24(21,22)10(11,12)13;/h4-5,7,14H,3H2,1-2H3,(H,17,18);/q;+1/p-1/t4-,5+,7-;/m1./s1 |
| InChIKey | YYGLMPMWCRWHRY-PKLNKYFDSA-M |
| XLogP | -5.46 |
| TPSA | 140.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.33 |
| LogP ≤ 5 | -5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |