C10H11NNa2O7S — CID 53324785
disodium;(2S,5R,6R)-6-(carboxylatomethyl)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 53324785) has the molecular formula C10H11NNa2O7S and a molecular weight of 335.25 g/mol. Its IUPAC name is disodium;(2S,5R,6R)-6-(carboxylatomethyl)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | disodium;(2S,5R,6R)-6-(carboxylatomethyl)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 53324785 |
| Molecular Formula | C10H11NNa2O7S |
| Molecular Weight | 335.25 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | disodium;(2S,5R,6R)-6-(carboxylatomethyl)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(C)[C@H](C(=O)[O-])N2C(=O)[C@@H](CC(=O)[O-])[C@H]2S1(=O)=O.[Na+].[Na+] |
| InChI | InChI=1S/C10H13NO7S.2Na/c1-10(2)6(9(15)16)11-7(14)4(3-5(12)13)8(11)19(10,17)18;;/h4,6,8H,3H2,1-2H3,(H,12,13)(H,15,16);;/q;2*+1/p-2/t4-,6+,8-;;/m1../s1 |
| InChIKey | LPHPHAFKCAQTQX-QSPJISJUSA-L |
| XLogP | -9.76 |
| TPSA | 134.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.25 |
| LogP ≤ 5 | -9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |