C10H13NO7S — CID 53324786
(2S,5R,6R)-6-(carboxymethyl)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 53324786) has the molecular formula C10H13NO7S and a molecular weight of 291.28 g/mol. Its IUPAC name is (2S,5R,6R)-6-(carboxymethyl)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R,6R)-6-(carboxymethyl)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 53324786 |
| Molecular Formula | C10H13NO7S |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | (2S,5R,6R)-6-(carboxymethyl)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC1(C)[C@H](C(=O)O)N2C(=O)[C@@H](CC(=O)O)[C@H]2S1(=O)=O |
| InChI | InChI=1S/C10H13NO7S/c1-10(2)6(9(15)16)11-7(14)4(3-5(12)13)8(11)19(10,17)18/h4,6,8H,3H2,1-2H3,(H,12,13)(H,15,16)/t4-,6+,8-/m1/s1 |
| InChIKey | LOWCQEDPHDQDQS-GZDOIFTASA-N |
| XLogP | -1.09 |
| TPSA | 129.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |