C26H37N3O2 — CID 53324839
tert-butyl N-[[3-[[[1-(2-phenylethyl)piperidin-4-yl]amino]methyl]phenyl]methyl]carbamate (PubChem CID 53324839) has the molecular formula C26H37N3O2 and a molecular weight of 423.60 g/mol. Its IUPAC name is tert-butyl N-[[3-[[[1-(2-phenylethyl)piperidin-4-yl]amino]methyl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-[[[1-(2-phenylethyl)piperidin-4-yl]amino]methyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 53324839 |
| Molecular Formula | C26H37N3O2 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.29 |
| IUPAC Name | tert-butyl N-[[3-[[[1-(2-phenylethyl)piperidin-4-yl]amino]methyl]phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cccc(CNC2CCN(CCc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C26H37N3O2/c1-26(2,3)31-25(30)28-20-23-11-7-10-22(18-23)19-27-24-13-16-29(17-14-24)15-12-21-8-5-4-6-9-21/h4-11,18,24,27H,12-17,19-20H2,1-3H3,(H,28,30) |
| InChIKey | QPGCADBRIYHYPP-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |