C14H18Cl2N2O6S — CID 53324864
[(2R,3S)-2-[(2,2-dichloroacetyl)amino]-3-hydroxy-3-(4-methylsulfonylphenyl)propyl] 2-aminoacetate (PubChem CID 53324864) has the molecular formula C14H18Cl2N2O6S and a molecular weight of 413.28 g/mol. Its IUPAC name is [(2R,3S)-2-[(2,2-dichloroacetyl)amino]-3-hydroxy-3-(4-methylsulfonylphenyl)propyl] 2-aminoacetate.
| Compound Name | [(2R,3S)-2-[(2,2-dichloroacetyl)amino]-3-hydroxy-3-(4-methylsulfonylphenyl)propyl] 2-aminoacetate |
|---|---|
| PubChem CID | 53324864 |
| Molecular Formula | C14H18Cl2N2O6S |
| Molecular Weight | 413.28 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | [(2R,3S)-2-[(2,2-dichloroacetyl)amino]-3-hydroxy-3-(4-methylsulfonylphenyl)propyl] 2-aminoacetate |
| SMILES | CS(=O)(=O)c1ccc([C@H](O)[C@@H](COC(=O)CN)NC(=O)C(Cl)Cl)cc1 |
| InChI | InChI=1S/C14H18Cl2N2O6S/c1-25(22,23)9-4-2-8(3-5-9)12(20)10(7-24-11(19)6-17)18-14(21)13(15)16/h2-5,10,12-13,20H,6-7,17H2,1H3,(H,18,21)/t10-,12+/m1/s1 |
| InChIKey | AMGKHLVPQHMHGQ-PWSUYJOCSA-N |
| XLogP | -0.09 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.28 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|