About 1-amino-1,3-dihydroinden-2-one
1-amino-1,3-dihydroinden-2-one (PubChem CID 53324937) has the molecular formula C9H9NO
and a molecular weight of 147.18 g/mol. Its IUPAC name is 1-amino-1,3-dihydroinden-2-one.
Molecular Properties
| Compound Name | 1-amino-1,3-dihydroinden-2-one |
| PubChem CID | 53324937 |
| Molecular Formula | C9H9NO |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | 1-amino-1,3-dihydroinden-2-one |
| SMILES | NC1C(=O)Cc2ccccc21 |
| InChI | InChI=1S/C9H9NO/c10-9-7-4-2-1-3-6(7)5-8(9)11/h1-4,9H,5,10H2 |
| InChIKey | HCRDTOBZDXBRAC-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-amino-1,3-dihydroinden-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-1,3-dihydroinden-2-one?
The IUPAC name of 1-amino-1,3-dihydroinden-2-one (CID 53324937) is 1-amino-1,3-dihydroinden-2-one.
What is the SMILES notation for 1-amino-1,3-dihydroinden-2-one?
The canonical SMILES for 1-amino-1,3-dihydroinden-2-one is NC1C(=O)Cc2ccccc21.
What is the InChIKey of 1-amino-1,3-dihydroinden-2-one?
The InChIKey is HCRDTOBZDXBRAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO/c10-9-7-4-2-1-3-6(7)5-8(9)11/h1-4,9H,5,10H2.
What are the key properties of 1-amino-1,3-dihydroinden-2-one?
1-amino-1,3-dihydroinden-2-one has a molecular weight of 147.18 g/mol, XLogP of 0.81, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-1,3-dihydroinden-2-one is sourced from PubChem (CID 53324937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).