About 1-[1-(3,4-dichlorophenyl)cyclobutyl]-N,N-dimethylmethanamine
1-[1-(3,4-dichlorophenyl)cyclobutyl]-N,N-dimethylmethanamine (PubChem CID 53325028) has the molecular formula C13H17Cl2N
and a molecular weight of 258.19 g/mol. Its IUPAC name is 1-[1-(3,4-dichlorophenyl)cyclobutyl]-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-[1-(3,4-dichlorophenyl)cyclobutyl]-N,N-dimethylmethanamine |
| PubChem CID | 53325028 |
| Molecular Formula | C13H17Cl2N |
| Molecular Weight | 258.19 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 1-[1-(3,4-dichlorophenyl)cyclobutyl]-N,N-dimethylmethanamine |
| SMILES | CN(C)CC1(c2ccc(Cl)c(Cl)c2)CCC1 |
| InChI | InChI=1S/C13H17Cl2N/c1-16(2)9-13(6-3-7-13)10-4-5-11(14)12(15)8-10/h4-5,8H,3,6-7,9H2,1-2H3 |
| InChIKey | MKEIWZZHDFWQBD-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.19 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[1-(3,4-dichlorophenyl)cyclobutyl]-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(3,4-dichlorophenyl)cyclobutyl]-N,N-dimethylmethanamine?
The IUPAC name of 1-[1-(3,4-dichlorophenyl)cyclobutyl]-N,N-dimethylmethanamine (CID 53325028) is 1-[1-(3,4-dichlorophenyl)cyclobutyl]-N,N-dimethylmethanamine.
What is the SMILES notation for 1-[1-(3,4-dichlorophenyl)cyclobutyl]-N,N-dimethylmethanamine?
The canonical SMILES for 1-[1-(3,4-dichlorophenyl)cyclobutyl]-N,N-dimethylmethanamine is CN(C)CC1(c2ccc(Cl)c(Cl)c2)CCC1.
What is the InChIKey of 1-[1-(3,4-dichlorophenyl)cyclobutyl]-N,N-dimethylmethanamine?
The InChIKey is MKEIWZZHDFWQBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17Cl2N/c1-16(2)9-13(6-3-7-13)10-4-5-11(14)12(15)8-10/h4-5,8H,3,6-7,9H2,1-2H3.
What are the key properties of 1-[1-(3,4-dichlorophenyl)cyclobutyl]-N,N-dimethylmethanamine?
1-[1-(3,4-dichlorophenyl)cyclobutyl]-N,N-dimethylmethanamine has a molecular weight of 258.19 g/mol, XLogP of 3.98, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(3,4-dichlorophenyl)cyclobutyl]-N,N-dimethylmethanamine is sourced from PubChem (CID 53325028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).