About [4-methoxy-3-[2-(1,3-thiazol-2-yl)ethynyl]phenyl]-(4-pyridin-2-ylpiperazin-1-yl)methanone
[4-methoxy-3-[2-(1,3-thiazol-2-yl)ethynyl]phenyl]-(4-pyridin-2-ylpiperazin-1-yl)methanone (PubChem CID 53325116) has the molecular formula C22H20N4O2S
and a molecular weight of 404.50 g/mol. Its IUPAC name is [4-methoxy-3-[2-(1,3-thiazol-2-yl)ethynyl]phenyl]-(4-pyridin-2-ylpiperazin-1-yl)methanone.
Molecular Properties
| Compound Name | [4-methoxy-3-[2-(1,3-thiazol-2-yl)ethynyl]phenyl]-(4-pyridin-2-ylpiperazin-1-yl)methanone |
| PubChem CID | 53325116 |
| Molecular Formula | C22H20N4O2S |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | [4-methoxy-3-[2-(1,3-thiazol-2-yl)ethynyl]phenyl]-(4-pyridin-2-ylpiperazin-1-yl)methanone |
| SMILES | COc1ccc(C(=O)N2CCN(c3ccccn3)CC2)cc1C#Cc1nccs1 |
| InChI | InChI=1S/C22H20N4O2S/c1-28-19-7-5-18(16-17(19)6-8-21-24-10-15-29-21)22(27)26-13-11-25(12-14-26)20-4-2-3-9-23-20/h2-5,7,9-10,15-16H,11-14H2,1H3 |
| InChIKey | RCQGDNPNQINBIG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-methoxy-3-[2-(1,3-thiazol-2-yl)ethynyl]phenyl]-(4-pyridin-2-ylpiperazin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-methoxy-3-[2-(1,3-thiazol-2-yl)ethynyl]phenyl]-(4-pyridin-2-ylpiperazin-1-yl)methanone?
The IUPAC name of [4-methoxy-3-[2-(1,3-thiazol-2-yl)ethynyl]phenyl]-(4-pyridin-2-ylpiperazin-1-yl)methanone (CID 53325116) is [4-methoxy-3-[2-(1,3-thiazol-2-yl)ethynyl]phenyl]-(4-pyridin-2-ylpiperazin-1-yl)methanone.
What is the SMILES notation for [4-methoxy-3-[2-(1,3-thiazol-2-yl)ethynyl]phenyl]-(4-pyridin-2-ylpiperazin-1-yl)methanone?
The canonical SMILES for [4-methoxy-3-[2-(1,3-thiazol-2-yl)ethynyl]phenyl]-(4-pyridin-2-ylpiperazin-1-yl)methanone is COc1ccc(C(=O)N2CCN(c3ccccn3)CC2)cc1C#Cc1nccs1.
What is the InChIKey of [4-methoxy-3-[2-(1,3-thiazol-2-yl)ethynyl]phenyl]-(4-pyridin-2-ylpiperazin-1-yl)methanone?
The InChIKey is RCQGDNPNQINBIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N4O2S/c1-28-19-7-5-18(16-17(19)6-8-21-24-10-15-29-21)22(27)26-13-11-25(12-14-26)20-4-2-3-9-23-20/h2-5,7,9-10,15-16H,11-14H2,1H3.
What are the key properties of [4-methoxy-3-[2-(1,3-thiazol-2-yl)ethynyl]phenyl]-(4-pyridin-2-ylpiperazin-1-yl)methanone?
[4-methoxy-3-[2-(1,3-thiazol-2-yl)ethynyl]phenyl]-(4-pyridin-2-ylpiperazin-1-yl)methanone has a molecular weight of 404.50 g/mol, XLogP of 2.91, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-methoxy-3-[2-(1,3-thiazol-2-yl)ethynyl]phenyl]-(4-pyridin-2-ylpiperazin-1-yl)methanone is sourced from PubChem (CID 53325116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).