C24H28F3N3O4S — CID 53325153
[5-(4-methylpiperazin-1-yl)-1,3-dihydroisoindol-2-yl]-[5-methylsulfonyl-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxyphenyl]methanone (PubChem CID 53325153) has the molecular formula C24H28F3N3O4S and a molecular weight of 511.57 g/mol. Its IUPAC name is [5-(4-methylpiperazin-1-yl)-1,3-dihydroisoindol-2-yl]-[5-methylsulfonyl-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxyphenyl]methanone.
| Compound Name | [5-(4-methylpiperazin-1-yl)-1,3-dihydroisoindol-2-yl]-[5-methylsulfonyl-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxyphenyl]methanone |
|---|---|
| PubChem CID | 53325153 |
| Molecular Formula | C24H28F3N3O4S |
| Molecular Weight | 511.57 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | [5-(4-methylpiperazin-1-yl)-1,3-dihydroisoindol-2-yl]-[5-methylsulfonyl-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxyphenyl]methanone |
| SMILES | C[C@H](Oc1ccc(S(C)(=O)=O)cc1C(=O)N1Cc2ccc(N3CCN(C)CC3)cc2C1)C(F)(F)F |
| InChI | InChI=1S/C24H28F3N3O4S/c1-16(24(25,26)27)34-22-7-6-20(35(3,32)33)13-21(22)23(31)30-14-17-4-5-19(12-18(17)15-30)29-10-8-28(2)9-11-29/h4-7,12-13,16H,8-11,14-15H2,1-3H3/t16-/m0/s1 |
| InChIKey | PGCHCAHHIBWCPB-INIZCTEOSA-N |
| XLogP | 3.33 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.57 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|