C30H29F2N7O4 — CID 53325161
(E)-N-[4-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]piperazin-1-yl]phenyl]-3-(3-nitrophenyl)prop-2-enamide (PubChem CID 53325161) has the molecular formula C30H29F2N7O4 and a molecular weight of 589.60 g/mol. Its IUPAC name is (E)-N-[4-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]piperazin-1-yl]phenyl]-3-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]piperazin-1-yl]phenyl]-3-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 53325161 |
| Molecular Formula | C30H29F2N7O4 |
| Molecular Weight | 589.60 g/mol |
| Exact Mass | 589.22 |
| IUPAC Name | (E)-N-[4-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]piperazin-1-yl]phenyl]-3-(3-nitrophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc([N+](=O)[O-])c1)Nc1ccc(N2CCN(CC(O)(Cn3cncn3)c3ccc(F)cc3F)CC2)cc1 |
| InChI | InChI=1S/C30H29F2N7O4/c31-23-5-10-27(28(32)17-23)30(41,19-38-21-33-20-34-38)18-36-12-14-37(15-13-36)25-8-6-24(7-9-25)35-29(40)11-4-22-2-1-3-26(16-22)39(42)43/h1-11,16-17,20-21,41H,12-15,18-19H2,(H,35,40)/b11-4+ |
| InChIKey | QCDHFJFUNFNDIT-NYYWCZLTSA-N |
| XLogP | 3.83 |
| TPSA | 129.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.60 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|