C31H43N5O5S — CID 53325202
2-[8-(4-tert-butylbenzoyl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl]-N-[4-(methanesulfonamido)butyl]acetamide (PubChem CID 53325202) has the molecular formula C31H43N5O5S and a molecular weight of 597.78 g/mol. Its IUPAC name is 2-[8-(4-tert-butylbenzoyl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl]-N-[4-(methanesulfonamido)butyl]acetamide.
| Compound Name | 2-[8-(4-tert-butylbenzoyl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl]-N-[4-(methanesulfonamido)butyl]acetamide |
|---|---|
| PubChem CID | 53325202 |
| Molecular Formula | C31H43N5O5S |
| Molecular Weight | 597.78 g/mol |
| Exact Mass | 597.30 |
| IUPAC Name | 2-[8-(4-tert-butylbenzoyl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl]-N-[4-(methanesulfonamido)butyl]acetamide |
| SMILES | CC(C)(C)c1ccc(C(=O)N2CCC3(CC2)C(=O)N(CC(=O)NCCCCNS(C)(=O)=O)CN3c2ccccc2)cc1 |
| InChI | InChI=1S/C31H43N5O5S/c1-30(2,3)25-14-12-24(13-15-25)28(38)34-20-16-31(17-21-34)29(39)35(23-36(31)26-10-6-5-7-11-26)22-27(37)32-18-8-9-19-33-42(4,40)41/h5-7,10-15,33H,8-9,16-23H2,1-4H3,(H,32,37) |
| InChIKey | DRWBYKJPFLJNIU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 119.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.78 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|