C28H33ClF2N6O3 — CID 53325211
5-chloro-2-N-[3-(2,2-difluoroethyl)-7-methoxy-1,2,4,5-tetrahydro-3-benzazepin-8-yl]-4-N-(2-methoxy-4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine (PubChem CID 53325211) has the molecular formula C28H33ClF2N6O3 and a molecular weight of 575.06 g/mol. Its IUPAC name is 5-chloro-2-N-[3-(2,2-difluoroethyl)-7-methoxy-1,2,4,5-tetrahydro-3-benzazepin-8-yl]-4-N-(2-methoxy-4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-2-N-[3-(2,2-difluoroethyl)-7-methoxy-1,2,4,5-tetrahydro-3-benzazepin-8-yl]-4-N-(2-methoxy-4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 53325211 |
| Molecular Formula | C28H33ClF2N6O3 |
| Molecular Weight | 575.06 g/mol |
| Exact Mass | 574.23 |
| IUPAC Name | 5-chloro-2-N-[3-(2,2-difluoroethyl)-7-methoxy-1,2,4,5-tetrahydro-3-benzazepin-8-yl]-4-N-(2-methoxy-4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine |
| SMILES | COc1cc2c(cc1Nc1ncc(Cl)c(Nc3ccc(N4CCOCC4)cc3OC)n1)CCN(CC(F)F)CC2 |
| InChI | InChI=1S/C28H33ClF2N6O3/c1-38-24-14-19-6-8-36(17-26(30)31)7-5-18(19)13-23(24)34-28-32-16-21(29)27(35-28)33-22-4-3-20(15-25(22)39-2)37-9-11-40-12-10-37/h3-4,13-16,26H,5-12,17H2,1-2H3,(H2,32,33,34,35) |
| InChIKey | NBZWPAGHNPREBR-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 84.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.06 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |