C22H21F3O5S2 — CID 53325316
(2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[3-[(5-thiophen-3-ylthiophen-2-yl)methyl]-4-(trifluoromethyl)phenyl]oxane-3,4,5-triol (PubChem CID 53325316) has the molecular formula C22H21F3O5S2 and a molecular weight of 486.53 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[3-[(5-thiophen-3-ylthiophen-2-yl)methyl]-4-(trifluoromethyl)phenyl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[3-[(5-thiophen-3-ylthiophen-2-yl)methyl]-4-(trifluoromethyl)phenyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 53325316 |
| Molecular Formula | C22H21F3O5S2 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.08 |
| IUPAC Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[3-[(5-thiophen-3-ylthiophen-2-yl)methyl]-4-(trifluoromethyl)phenyl]oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2ccc(C(F)(F)F)c(Cc3ccc(-c4ccsc4)s3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H21F3O5S2/c23-22(24,25)15-3-1-11(21-20(29)19(28)18(27)16(9-26)30-21)7-13(15)8-14-2-4-17(32-14)12-5-6-31-10-12/h1-7,10,16,18-21,26-29H,8-9H2/t16-,18-,19+,20-,21+/m1/s1 |
| InChIKey | XBVRNDOLXNJDRK-RQXATKFSSA-N |
| XLogP | 3.60 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |