C21H20N2O6S — CID 53325317
2-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]-4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzonitrile (PubChem CID 53325317) has the molecular formula C21H20N2O6S and a molecular weight of 428.47 g/mol. Its IUPAC name is 2-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]-4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzonitrile.
| Compound Name | 2-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]-4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 53325317 |
| Molecular Formula | C21H20N2O6S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 2-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]-4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzonitrile |
| SMILES | N#Cc1ccc([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1Cc1ncc(-c2ccco2)s1 |
| InChI | InChI=1S/C21H20N2O6S/c22-8-12-4-3-11(21-20(27)19(26)18(25)15(10-24)29-21)6-13(12)7-17-23-9-16(30-17)14-2-1-5-28-14/h1-6,9,15,18-21,24-27H,7,10H2/t15-,18-,19+,20-,21+/m1/s1 |
| InChIKey | JJNONZCQHVTQGR-GRARQNNCSA-N |
| XLogP | 1.38 |
| TPSA | 139.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |