C23H35NO2 — CID 53325344
(4Z,7Z,10Z,12Z,15Z,18Z)-N-(2-hydroxyethyl)henicosa-4,7,10,12,15,18-hexaenamide (PubChem CID 53325344) has the molecular formula C23H35NO2 and a molecular weight of 357.54 g/mol. Its IUPAC name is (4Z,7Z,10Z,12Z,15Z,18Z)-N-(2-hydroxyethyl)henicosa-4,7,10,12,15,18-hexaenamide.
| Compound Name | (4Z,7Z,10Z,12Z,15Z,18Z)-N-(2-hydroxyethyl)henicosa-4,7,10,12,15,18-hexaenamide |
|---|---|
| PubChem CID | 53325344 |
| Molecular Formula | C23H35NO2 |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.27 |
| IUPAC Name | (4Z,7Z,10Z,12Z,15Z,18Z)-N-(2-hydroxyethyl)henicosa-4,7,10,12,15,18-hexaenamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C=C/C/C=C\C/C=C\CCC(=O)NCCO |
| InChI | InChI=1S/C23H35NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23(26)24-21-22-25/h3-4,6-7,9-12,14-15,17-18,25H,2,5,8,13,16,19-22H2,1H3,(H,24,26)/b4-3-,7-6-,10-9-,12-11-,15-14-,18-17- |
| InChIKey | IKTSAEAKQWDQDU-MBMMKWFLSA-N |
| XLogP | 5.18 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|