C14H19N3O4S — CID 53325394
N-[(3R,5R)-1-cyano-5-methylpyrrolidin-3-yl]-2,5-dimethoxybenzenesulfonamide (PubChem CID 53325394) has the molecular formula C14H19N3O4S and a molecular weight of 325.39 g/mol. Its IUPAC name is N-[(3R,5R)-1-cyano-5-methylpyrrolidin-3-yl]-2,5-dimethoxybenzenesulfonamide.
| Compound Name | N-[(3R,5R)-1-cyano-5-methylpyrrolidin-3-yl]-2,5-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 53325394 |
| Molecular Formula | C14H19N3O4S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | N-[(3R,5R)-1-cyano-5-methylpyrrolidin-3-yl]-2,5-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N[C@@H]2C[C@@H](C)N(C#N)C2)c1 |
| InChI | InChI=1S/C14H19N3O4S/c1-10-6-11(8-17(10)9-15)16-22(18,19)14-7-12(20-2)4-5-13(14)21-3/h4-5,7,10-11,16H,6,8H2,1-3H3/t10-,11-/m1/s1 |
| InChIKey | OBODFDBEYMKZMM-GHMZBOCLSA-N |
| XLogP | 0.93 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|