C22H30N2O2 — CID 53325433
(1R,2R,9S,17S)-4-phenylmethoxy-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one (PubChem CID 53325433) has the molecular formula C22H30N2O2 and a molecular weight of 354.49 g/mol. Its IUPAC name is (1R,2R,9S,17S)-4-phenylmethoxy-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one.
| Compound Name | (1R,2R,9S,17S)-4-phenylmethoxy-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one |
|---|---|
| PubChem CID | 53325433 |
| Molecular Formula | C22H30N2O2 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | (1R,2R,9S,17S)-4-phenylmethoxy-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one |
| SMILES | O=C1CC(OCc2ccccc2)C[C@@H]2[C@H]3CCCN4CCC[C@@H](CN12)[C@@H]34 |
| InChI | InChI=1S/C22H30N2O2/c25-21-13-18(26-15-16-6-2-1-3-7-16)12-20-19-9-5-11-23-10-4-8-17(22(19)23)14-24(20)21/h1-3,6-7,17-20,22H,4-5,8-15H2/t17-,18?,19+,20+,22-/m0/s1 |
| InChIKey | NIZDXKKKAUREEY-RKYXSEDCSA-N |
| XLogP | 3.07 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |