C31H38O4 — CID 53325483
3-hydroxy-5-methoxy-4,6,6-tris(3-methylbut-2-enyl)-2-[(E)-3-phenylprop-2-enoyl]cyclohexa-2,4-dien-1-one (PubChem CID 53325483) has the molecular formula C31H38O4 and a molecular weight of 474.64 g/mol. Its IUPAC name is 3-hydroxy-5-methoxy-4,6,6-tris(3-methylbut-2-enyl)-2-[(E)-3-phenylprop-2-enoyl]cyclohexa-2,4-dien-1-one.
| Compound Name | 3-hydroxy-5-methoxy-4,6,6-tris(3-methylbut-2-enyl)-2-[(E)-3-phenylprop-2-enoyl]cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 53325483 |
| Molecular Formula | C31H38O4 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | 3-hydroxy-5-methoxy-4,6,6-tris(3-methylbut-2-enyl)-2-[(E)-3-phenylprop-2-enoyl]cyclohexa-2,4-dien-1-one |
| SMILES | COC1=C(CC=C(C)C)C(O)=C(C(=O)/C=C/c2ccccc2)C(=O)C1(CC=C(C)C)CC=C(C)C |
| InChI | InChI=1S/C31H38O4/c1-21(2)13-15-25-28(33)27(26(32)16-14-24-11-9-8-10-12-24)29(34)31(30(25)35-7,19-17-22(3)4)20-18-23(5)6/h8-14,16-18,33H,15,19-20H2,1-7H3/b16-14+ |
| InChIKey | AMQAKUNNWWKAHP-JQIJEIRASA-N |
| XLogP | 7.62 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|