C25H27N4O8PS — CID 53325561
methyl (2S)-2-[[[(2R,3S,4R,5R)-3,4-dihydroxy-5-(4-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 53325561) has the molecular formula C25H27N4O8PS and a molecular weight of 574.55 g/mol. Its IUPAC name is methyl (2S)-2-[[[(2R,3S,4R,5R)-3,4-dihydroxy-5-(4-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[[(2R,3S,4R,5R)-3,4-dihydroxy-5-(4-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 53325561 |
| Molecular Formula | C25H27N4O8PS |
| Molecular Weight | 574.55 g/mol |
| Exact Mass | 574.13 |
| IUPAC Name | methyl (2S)-2-[[[(2R,3S,4R,5R)-3,4-dihydroxy-5-(4-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2ccc3c(-c4cccs4)ncnc32)[C@H](O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C25H27N4O8PS/c1-15(25(32)34-2)28-38(33,37-16-7-4-3-5-8-16)35-13-18-21(30)22(31)24(36-18)29-11-10-17-20(19-9-6-12-39-19)26-14-27-23(17)29/h3-12,14-15,18,21-22,24,30-31H,13H2,1-2H3,(H,28,33)/t15-,18+,21+,22+,24+,38?/m0/s1 |
| InChIKey | KUHHPXKBTRWVPB-DUBPGCDDSA-N |
| XLogP | 3.13 |
| TPSA | 154.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.55 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|