About 2-benzhydrylsulfinyl-N,N-dimethylacetamide
2-benzhydrylsulfinyl-N,N-dimethylacetamide (PubChem CID 53325625) has the molecular formula C17H19NO2S
and a molecular weight of 301.41 g/mol. Its IUPAC name is 2-benzhydrylsulfinyl-N,N-dimethylacetamide.
Molecular Properties
| Compound Name | 2-benzhydrylsulfinyl-N,N-dimethylacetamide |
| PubChem CID | 53325625 |
| Molecular Formula | C17H19NO2S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 2-benzhydrylsulfinyl-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CS(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H19NO2S/c1-18(2)16(19)13-21(20)17(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12,17H,13H2,1-2H3 |
| InChIKey | XUNMLWSOIMMAEQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzhydrylsulfinyl-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzhydrylsulfinyl-N,N-dimethylacetamide?
The IUPAC name of 2-benzhydrylsulfinyl-N,N-dimethylacetamide (CID 53325625) is 2-benzhydrylsulfinyl-N,N-dimethylacetamide.
What is the SMILES notation for 2-benzhydrylsulfinyl-N,N-dimethylacetamide?
The canonical SMILES for 2-benzhydrylsulfinyl-N,N-dimethylacetamide is CN(C)C(=O)CS(=O)C(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-benzhydrylsulfinyl-N,N-dimethylacetamide?
The InChIKey is XUNMLWSOIMMAEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO2S/c1-18(2)16(19)13-21(20)17(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12,17H,13H2,1-2H3.
What are the key properties of 2-benzhydrylsulfinyl-N,N-dimethylacetamide?
2-benzhydrylsulfinyl-N,N-dimethylacetamide has a molecular weight of 301.41 g/mol, XLogP of 2.61, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzhydrylsulfinyl-N,N-dimethylacetamide is sourced from PubChem (CID 53325625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).