C19H17N5O2S — CID 53325795
6-(4-methoxyphenyl)-2-(4-phenyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-4,5-dihydropyridazin-3-one (PubChem CID 53325795) has the molecular formula C19H17N5O2S and a molecular weight of 379.45 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-2-(4-phenyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-4,5-dihydropyridazin-3-one.
| Compound Name | 6-(4-methoxyphenyl)-2-(4-phenyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-4,5-dihydropyridazin-3-one |
|---|---|
| PubChem CID | 53325795 |
| Molecular Formula | C19H17N5O2S |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 6-(4-methoxyphenyl)-2-(4-phenyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-4,5-dihydropyridazin-3-one |
| SMILES | COc1ccc(C2=NN(c3n[nH]c(=S)n3-c3ccccc3)C(=O)CC2)cc1 |
| InChI | InChI=1S/C19H17N5O2S/c1-26-15-9-7-13(8-10-15)16-11-12-17(25)24(22-16)18-20-21-19(27)23(18)14-5-3-2-4-6-14/h2-10H,11-12H2,1H3,(H,21,27) |
| InChIKey | CWOPXZSPCSSBCP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 75.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|