About 2-[[3-[[3,5-bis[4-(trifluoromethoxy)phenyl]pyrazol-1-yl]methyl]benzoyl]amino]acetic acid
2-[[3-[[3,5-bis[4-(trifluoromethoxy)phenyl]pyrazol-1-yl]methyl]benzoyl]amino]acetic acid (PubChem CID 53325825) has the molecular formula C27H19F6N3O5
and a molecular weight of 579.45 g/mol. Its IUPAC name is 2-[[3-[[3,5-bis[4-(trifluoromethoxy)phenyl]pyrazol-1-yl]methyl]benzoyl]amino]acetic acid.
Molecular Properties
| Compound Name | 2-[[3-[[3,5-bis[4-(trifluoromethoxy)phenyl]pyrazol-1-yl]methyl]benzoyl]amino]acetic acid |
| PubChem CID | 53325825 |
| Molecular Formula | C27H19F6N3O5 |
| Molecular Weight | 579.45 g/mol |
| Exact Mass | 579.12 |
| IUPAC Name | 2-[[3-[[3,5-bis[4-(trifluoromethoxy)phenyl]pyrazol-1-yl]methyl]benzoyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)c1cccc(Cn2nc(-c3ccc(OC(F)(F)F)cc3)cc2-c2ccc(OC(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C27H19F6N3O5/c28-26(29,30)40-20-8-4-17(5-9-20)22-13-23(18-6-10-21(11-7-18)41-27(31,32)33)36(35-22)15-16-2-1-3-19(12-16)25(39)34-14-24(37)38/h1-13H,14-15H2,(H,34,39)(H,37,38) |
| InChIKey | OJQZTSVYSBSEHY-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 579.45 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[3-[[3,5-bis[4-(trifluoromethoxy)phenyl]pyrazol-1-yl]methyl]benzoyl]amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3-[[3,5-bis[4-(trifluoromethoxy)phenyl]pyrazol-1-yl]methyl]benzoyl]amino]acetic acid?
The IUPAC name of 2-[[3-[[3,5-bis[4-(trifluoromethoxy)phenyl]pyrazol-1-yl]methyl]benzoyl]amino]acetic acid (CID 53325825) is 2-[[3-[[3,5-bis[4-(trifluoromethoxy)phenyl]pyrazol-1-yl]methyl]benzoyl]amino]acetic acid.
What is the SMILES notation for 2-[[3-[[3,5-bis[4-(trifluoromethoxy)phenyl]pyrazol-1-yl]methyl]benzoyl]amino]acetic acid?
The canonical SMILES for 2-[[3-[[3,5-bis[4-(trifluoromethoxy)phenyl]pyrazol-1-yl]methyl]benzoyl]amino]acetic acid is O=C(O)CNC(=O)c1cccc(Cn2nc(-c3ccc(OC(F)(F)F)cc3)cc2-c2ccc(OC(F)(F)F)cc2)c1.
What is the InChIKey of 2-[[3-[[3,5-bis[4-(trifluoromethoxy)phenyl]pyrazol-1-yl]methyl]benzoyl]amino]acetic acid?
The InChIKey is OJQZTSVYSBSEHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H19F6N3O5/c28-26(29,30)40-20-8-4-17(5-9-20)22-13-23(18-6-10-21(11-7-18)41-27(31,32)33)36(35-22)15-16-2-1-3-19(12-16)25(39)34-14-24(37)38/h1-13H,14-15H2,(H,34,39)(H,37,38).
What are the key properties of 2-[[3-[[3,5-bis[4-(trifluoromethoxy)phenyl]pyrazol-1-yl]methyl]benzoyl]amino]acetic acid?
2-[[3-[[3,5-bis[4-(trifluoromethoxy)phenyl]pyrazol-1-yl]methyl]benzoyl]amino]acetic acid has a molecular weight of 579.45 g/mol, XLogP of 5.88, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3-[[3,5-bis[4-(trifluoromethoxy)phenyl]pyrazol-1-yl]methyl]benzoyl]amino]acetic acid is sourced from PubChem (CID 53325825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).