C20H19N3O2S — CID 53325830
1-[3-[[(1Z)-1-hydroxyimino-2,3-dihydroinden-5-yl]amino]thieno[2,3-c]pyridin-2-yl]butan-1-one (PubChem CID 53325830) has the molecular formula C20H19N3O2S and a molecular weight of 365.46 g/mol. Its IUPAC name is 1-[3-[[(1Z)-1-hydroxyimino-2,3-dihydroinden-5-yl]amino]thieno[2,3-c]pyridin-2-yl]butan-1-one.
| Compound Name | 1-[3-[[(1Z)-1-hydroxyimino-2,3-dihydroinden-5-yl]amino]thieno[2,3-c]pyridin-2-yl]butan-1-one |
|---|---|
| PubChem CID | 53325830 |
| Molecular Formula | C20H19N3O2S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 1-[3-[[(1Z)-1-hydroxyimino-2,3-dihydroinden-5-yl]amino]thieno[2,3-c]pyridin-2-yl]butan-1-one |
| SMILES | CCCC(=O)c1sc2cnccc2c1Nc1ccc2c(c1)CC/C2=N/O |
| InChI | InChI=1S/C20H19N3O2S/c1-2-3-17(24)20-19(15-8-9-21-11-18(15)26-20)22-13-5-6-14-12(10-13)4-7-16(14)23-25/h5-6,8-11,22,25H,2-4,7H2,1H3/b23-16- |
| InChIKey | WGSDNUGDMNQTLN-KQWNVCNZSA-N |
| XLogP | 5.15 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|