C18H26O4 — CID 53325864
[(2S)-4-[(3aR,4aS,5S,5aR,6aR)-4a,5a-dimethyl-3-methylidene-2-oxo-4,5,6,6a-tetrahydro-3aH-cyclopropa[f][1]benzofuran-5-yl]butan-2-yl] acetate (PubChem CID 53325864) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is [(2S)-4-[(3aR,4aS,5S,5aR,6aR)-4a,5a-dimethyl-3-methylidene-2-oxo-4,5,6,6a-tetrahydro-3aH-cyclopropa[f][1]benzofuran-5-yl]butan-2-yl] acetate.
| Compound Name | [(2S)-4-[(3aR,4aS,5S,5aR,6aR)-4a,5a-dimethyl-3-methylidene-2-oxo-4,5,6,6a-tetrahydro-3aH-cyclopropa[f][1]benzofuran-5-yl]butan-2-yl] acetate |
|---|---|
| PubChem CID | 53325864 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | [(2S)-4-[(3aR,4aS,5S,5aR,6aR)-4a,5a-dimethyl-3-methylidene-2-oxo-4,5,6,6a-tetrahydro-3aH-cyclopropa[f][1]benzofuran-5-yl]butan-2-yl] acetate |
| SMILES | C=C1C(=O)O[C@@H]2C[C@]3(C)[C@@H](CC[C@H](C)OC(C)=O)[C@]3(C)C[C@H]12 |
| InChI | InChI=1S/C18H26O4/c1-10(21-12(3)19)6-7-15-17(4)8-13-11(2)16(20)22-14(13)9-18(15,17)5/h10,13-15H,2,6-9H2,1,3-5H3/t10-,13+,14+,15-,17-,18+/m0/s1 |
| InChIKey | USWATMHRMOTLRP-XUNGLMTJSA-N |
| XLogP | 3.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|