C13H17N5 — CID 53325935
8-(azetidin-1-yl)-2,6,7,12-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraene (PubChem CID 53325935) has the molecular formula C13H17N5 and a molecular weight of 243.31 g/mol. Its IUPAC name is 8-(azetidin-1-yl)-2,6,7,12-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraene.
| Compound Name | 8-(azetidin-1-yl)-2,6,7,12-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraene |
|---|---|
| PubChem CID | 53325935 |
| Molecular Formula | C13H17N5 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 8-(azetidin-1-yl)-2,6,7,12-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraene |
| SMILES | c1cc2nc3c(c(N4CCC4)n2n1)CCNCC3 |
| InChI | InChI=1S/C13H17N5/c1-8-17(9-1)13-10-2-5-14-6-3-11(10)16-12-4-7-15-18(12)13/h4,7,14H,1-3,5-6,8-9H2 |
| InChIKey | OXSBNXICTJBRGD-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 45.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |