C19H34O9 — CID 53326026
(2S,3R,4R,5S,6S)-2-(hydroxymethyl)-6-[(E,2R)-4-[(1S,2S,4R)-1,2,4-trihydroxy-2,6,6-trimethylcyclohexyl]but-3-en-2-yl]oxyoxane-3,4,5-triol (PubChem CID 53326026) has the molecular formula C19H34O9 and a molecular weight of 406.47 g/mol. Its IUPAC name is (2S,3R,4R,5S,6S)-2-(hydroxymethyl)-6-[(E,2R)-4-[(1S,2S,4R)-1,2,4-trihydroxy-2,6,6-trimethylcyclohexyl]but-3-en-2-yl]oxyoxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6S)-2-(hydroxymethyl)-6-[(E,2R)-4-[(1S,2S,4R)-1,2,4-trihydroxy-2,6,6-trimethylcyclohexyl]but-3-en-2-yl]oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 53326026 |
| Molecular Formula | C19H34O9 |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | (2S,3R,4R,5S,6S)-2-(hydroxymethyl)-6-[(E,2R)-4-[(1S,2S,4R)-1,2,4-trihydroxy-2,6,6-trimethylcyclohexyl]but-3-en-2-yl]oxyoxane-3,4,5-triol |
| SMILES | C[C@H](/C=C/[C@]1(O)C(C)(C)C[C@@H](O)C[C@]1(C)O)O[C@H]1O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H34O9/c1-10(27-16-15(24)14(23)13(22)12(9-20)28-16)5-6-19(26)17(2,3)7-11(21)8-18(19,4)25/h5-6,10-16,20-26H,7-9H2,1-4H3/b6-5+/t10-,11-,12+,13+,14-,15+,16+,18+,19+/m1/s1 |
| InChIKey | XZRJEYQBLXDNNU-FTAIXVFKSA-N |
| XLogP | -1.59 |
| TPSA | 160.07 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|