About 3-[1-[(2E)-3,7-dimethylocta-2,6-dienyl]triazol-4-yl]phenol
3-[1-[(2E)-3,7-dimethylocta-2,6-dienyl]triazol-4-yl]phenol (PubChem CID 53326227) has the molecular formula C18H23N3O
and a molecular weight of 297.40 g/mol. Its IUPAC name is 3-[1-[(2E)-3,7-dimethylocta-2,6-dienyl]triazol-4-yl]phenol.
Molecular Properties
| Compound Name | 3-[1-[(2E)-3,7-dimethylocta-2,6-dienyl]triazol-4-yl]phenol |
| PubChem CID | 53326227 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 3-[1-[(2E)-3,7-dimethylocta-2,6-dienyl]triazol-4-yl]phenol |
| SMILES | CC(C)=CCC/C(C)=C/Cn1cc(-c2cccc(O)c2)nn1 |
| InChI | InChI=1S/C18H23N3O/c1-14(2)6-4-7-15(3)10-11-21-13-18(19-20-21)16-8-5-9-17(22)12-16/h5-6,8-10,12-13,22H,4,7,11H2,1-3H3/b15-10+ |
| InChIKey | MSKZFDQYBCDMLA-XNTDXEJSSA-N |
| XLogP | 4.34 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[1-[(2E)-3,7-dimethylocta-2,6-dienyl]triazol-4-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-[(2E)-3,7-dimethylocta-2,6-dienyl]triazol-4-yl]phenol?
The IUPAC name of 3-[1-[(2E)-3,7-dimethylocta-2,6-dienyl]triazol-4-yl]phenol (CID 53326227) is 3-[1-[(2E)-3,7-dimethylocta-2,6-dienyl]triazol-4-yl]phenol.
What is the SMILES notation for 3-[1-[(2E)-3,7-dimethylocta-2,6-dienyl]triazol-4-yl]phenol?
The canonical SMILES for 3-[1-[(2E)-3,7-dimethylocta-2,6-dienyl]triazol-4-yl]phenol is CC(C)=CCC/C(C)=C/Cn1cc(-c2cccc(O)c2)nn1.
What is the InChIKey of 3-[1-[(2E)-3,7-dimethylocta-2,6-dienyl]triazol-4-yl]phenol?
The InChIKey is MSKZFDQYBCDMLA-XNTDXEJSSA-N. The full InChI is InChI=1S/C18H23N3O/c1-14(2)6-4-7-15(3)10-11-21-13-18(19-20-21)16-8-5-9-17(22)12-16/h5-6,8-10,12-13,22H,4,7,11H2,1-3H3/b15-10+.
What are the key properties of 3-[1-[(2E)-3,7-dimethylocta-2,6-dienyl]triazol-4-yl]phenol?
3-[1-[(2E)-3,7-dimethylocta-2,6-dienyl]triazol-4-yl]phenol has a molecular weight of 297.40 g/mol, XLogP of 4.34, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-[(2E)-3,7-dimethylocta-2,6-dienyl]triazol-4-yl]phenol is sourced from PubChem (CID 53326227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).