C20H19ClF2N2O — CID 53326232
(3R,4S)-8-chloro-5,7-difluoro-6-(1H-indol-7-yl)-2,2,4-trimethyl-3,4-dihydro-1H-quinolin-3-ol (PubChem CID 53326232) has the molecular formula C20H19ClF2N2O and a molecular weight of 376.83 g/mol. Its IUPAC name is (3R,4S)-8-chloro-5,7-difluoro-6-(1H-indol-7-yl)-2,2,4-trimethyl-3,4-dihydro-1H-quinolin-3-ol.
| Compound Name | (3R,4S)-8-chloro-5,7-difluoro-6-(1H-indol-7-yl)-2,2,4-trimethyl-3,4-dihydro-1H-quinolin-3-ol |
|---|---|
| PubChem CID | 53326232 |
| Molecular Formula | C20H19ClF2N2O |
| Molecular Weight | 376.83 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | (3R,4S)-8-chloro-5,7-difluoro-6-(1H-indol-7-yl)-2,2,4-trimethyl-3,4-dihydro-1H-quinolin-3-ol |
| SMILES | C[C@H]1c2c(F)c(-c3cccc4cc[nH]c34)c(F)c(Cl)c2NC(C)(C)[C@@H]1O |
| InChI | InChI=1S/C20H19ClF2N2O/c1-9-12-15(22)13(11-6-4-5-10-7-8-24-17(10)11)16(23)14(21)18(12)25-20(2,3)19(9)26/h4-9,19,24-26H,1-3H3/t9-,19+/m0/s1 |
| InChIKey | OKAULKUIKJJWBO-ZRNGKTOUSA-N |
| XLogP | 5.43 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.83 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|