C21H30N4O — CID 53326307
N'-[[6-(methoxymethyl)-2-pyridinyl]methyl]-N'-(5,6,7,8-tetrahydroquinolin-8-yl)butane-1,4-diamine (PubChem CID 53326307) has the molecular formula C21H30N4O and a molecular weight of 354.50 g/mol. Its IUPAC name is N'-[[6-(methoxymethyl)-2-pyridinyl]methyl]-N'-(5,6,7,8-tetrahydroquinolin-8-yl)butane-1,4-diamine.
| Compound Name | N'-[[6-(methoxymethyl)-2-pyridinyl]methyl]-N'-(5,6,7,8-tetrahydroquinolin-8-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 53326307 |
| Molecular Formula | C21H30N4O |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | N'-[[6-(methoxymethyl)-2-pyridinyl]methyl]-N'-(5,6,7,8-tetrahydroquinolin-8-yl)butane-1,4-diamine |
| SMILES | COCc1cccc(CN(CCCCN)C2CCCc3cccnc32)n1 |
| InChI | InChI=1S/C21H30N4O/c1-26-16-19-10-5-9-18(24-19)15-25(14-3-2-12-22)20-11-4-7-17-8-6-13-23-21(17)20/h5-6,8-10,13,20H,2-4,7,11-12,14-16,22H2,1H3 |
| InChIKey | OCIHURYPYFZKKV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|