C20H27N5 — CID 53326309
N'-(1H-benzimidazol-2-ylmethyl)-N'-(2-pyridin-2-ylpropan-2-yl)butane-1,4-diamine (PubChem CID 53326309) has the molecular formula C20H27N5 and a molecular weight of 337.47 g/mol. Its IUPAC name is N'-(1H-benzimidazol-2-ylmethyl)-N'-(2-pyridin-2-ylpropan-2-yl)butane-1,4-diamine.
| Compound Name | N'-(1H-benzimidazol-2-ylmethyl)-N'-(2-pyridin-2-ylpropan-2-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 53326309 |
| Molecular Formula | C20H27N5 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | N'-(1H-benzimidazol-2-ylmethyl)-N'-(2-pyridin-2-ylpropan-2-yl)butane-1,4-diamine |
| SMILES | CC(C)(c1ccccn1)N(CCCCN)Cc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H27N5/c1-20(2,18-11-5-7-13-22-18)25(14-8-6-12-21)15-19-23-16-9-3-4-10-17(16)24-19/h3-5,7,9-11,13H,6,8,12,14-15,21H2,1-2H3,(H,23,24) |
| InChIKey | ZFQCEZRNXZLHIX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|