About (1-ethylpiperidin-4-yl) N-(2-phenylphenyl)carbamate
(1-ethylpiperidin-4-yl) N-(2-phenylphenyl)carbamate (PubChem CID 53326338) has the molecular formula C20H24N2O2
and a molecular weight of 324.42 g/mol. Its IUPAC name is (1-ethylpiperidin-4-yl) N-(2-phenylphenyl)carbamate.
Molecular Properties
| Compound Name | (1-ethylpiperidin-4-yl) N-(2-phenylphenyl)carbamate |
| PubChem CID | 53326338 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | (1-ethylpiperidin-4-yl) N-(2-phenylphenyl)carbamate |
| SMILES | CCN1CCC(OC(=O)Nc2ccccc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C20H24N2O2/c1-2-22-14-12-17(13-15-22)24-20(23)21-19-11-7-6-10-18(19)16-8-4-3-5-9-16/h3-11,17H,2,12-15H2,1H3,(H,21,23) |
| InChIKey | SNSBQQKMJWPBHG-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-ethylpiperidin-4-yl) N-(2-phenylphenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethylpiperidin-4-yl) N-(2-phenylphenyl)carbamate?
The IUPAC name of (1-ethylpiperidin-4-yl) N-(2-phenylphenyl)carbamate (CID 53326338) is (1-ethylpiperidin-4-yl) N-(2-phenylphenyl)carbamate.
What is the SMILES notation for (1-ethylpiperidin-4-yl) N-(2-phenylphenyl)carbamate?
The canonical SMILES for (1-ethylpiperidin-4-yl) N-(2-phenylphenyl)carbamate is CCN1CCC(OC(=O)Nc2ccccc2-c2ccccc2)CC1.
What is the InChIKey of (1-ethylpiperidin-4-yl) N-(2-phenylphenyl)carbamate?
The InChIKey is SNSBQQKMJWPBHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N2O2/c1-2-22-14-12-17(13-15-22)24-20(23)21-19-11-7-6-10-18(19)16-8-4-3-5-9-16/h3-11,17H,2,12-15H2,1H3,(H,21,23).
What are the key properties of (1-ethylpiperidin-4-yl) N-(2-phenylphenyl)carbamate?
(1-ethylpiperidin-4-yl) N-(2-phenylphenyl)carbamate has a molecular weight of 324.42 g/mol, XLogP of 4.39, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethylpiperidin-4-yl) N-(2-phenylphenyl)carbamate is sourced from PubChem (CID 53326338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).