C23H22ClMgNO4 — CID 53326350
magnesium (Z)-4-[1-benzyl-4-[(4-chlorophenyl)methyl]piperidin-4-yl]-2-oxido-4-oxobut-2-enoate (PubChem CID 53326350) has the molecular formula C23H22ClMgNO4 and a molecular weight of 436.19 g/mol. Its IUPAC name is magnesium (Z)-4-[1-benzyl-4-[(4-chlorophenyl)methyl]piperidin-4-yl]-2-oxido-4-oxobut-2-enoate.
| Compound Name | magnesium (Z)-4-[1-benzyl-4-[(4-chlorophenyl)methyl]piperidin-4-yl]-2-oxido-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 53326350 |
| Molecular Formula | C23H22ClMgNO4 |
| Molecular Weight | 436.19 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | magnesium (Z)-4-[1-benzyl-4-[(4-chlorophenyl)methyl]piperidin-4-yl]-2-oxido-4-oxobut-2-enoate |
| SMILES | O=C([O-])/C([O-])=C/C(=O)C1(Cc2ccc(Cl)cc2)CCN(Cc2ccccc2)CC1.[Mg+2] |
| InChI | InChI=1S/C23H24ClNO4.Mg/c24-19-8-6-17(7-9-19)15-23(21(27)14-20(26)22(28)29)10-12-25(13-11-23)16-18-4-2-1-3-5-18;/h1-9,14,26H,10-13,15-16H2,(H,28,29);/q;+2/p-2/b20-14-; |
| InChIKey | JAZHKINYSNSVNB-VSOKSMTPSA-L |
| XLogP | 1.35 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.19 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|