C20H14F6N4O3 — CID 53326496
1-[3-[4-fluoro-2-(2,2,3,3,3-pentafluoropropoxy)phenyl]phenyl]pyrazole-3,5-dicarboxamide (PubChem CID 53326496) has the molecular formula C20H14F6N4O3 and a molecular weight of 472.35 g/mol. Its IUPAC name is 1-[3-[4-fluoro-2-(2,2,3,3,3-pentafluoropropoxy)phenyl]phenyl]pyrazole-3,5-dicarboxamide.
| Compound Name | 1-[3-[4-fluoro-2-(2,2,3,3,3-pentafluoropropoxy)phenyl]phenyl]pyrazole-3,5-dicarboxamide |
|---|---|
| PubChem CID | 53326496 |
| Molecular Formula | C20H14F6N4O3 |
| Molecular Weight | 472.35 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | 1-[3-[4-fluoro-2-(2,2,3,3,3-pentafluoropropoxy)phenyl]phenyl]pyrazole-3,5-dicarboxamide |
| SMILES | NC(=O)c1cc(C(N)=O)n(-c2cccc(-c3ccc(F)cc3OCC(F)(F)C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C20H14F6N4O3/c21-11-4-5-13(16(7-11)33-9-19(22,23)20(24,25)26)10-2-1-3-12(6-10)30-15(18(28)32)8-14(29-30)17(27)31/h1-8H,9H2,(H2,27,31)(H2,28,32) |
| InChIKey | WISFZHDUKWADFP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 113.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|