C25H23ClN6O2 — CID 53326513
2-[[5-chloro-2-[(1-methyl-2-oxo-4,5-dihydro-3H-1-benzazepin-7-yl)amino]pyrimidin-4-yl]amino]-N-prop-2-ynylbenzamide (PubChem CID 53326513) has the molecular formula C25H23ClN6O2 and a molecular weight of 474.95 g/mol. Its IUPAC name is 2-[[5-chloro-2-[(1-methyl-2-oxo-4,5-dihydro-3H-1-benzazepin-7-yl)amino]pyrimidin-4-yl]amino]-N-prop-2-ynylbenzamide.
| Compound Name | 2-[[5-chloro-2-[(1-methyl-2-oxo-4,5-dihydro-3H-1-benzazepin-7-yl)amino]pyrimidin-4-yl]amino]-N-prop-2-ynylbenzamide |
|---|---|
| PubChem CID | 53326513 |
| Molecular Formula | C25H23ClN6O2 |
| Molecular Weight | 474.95 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 2-[[5-chloro-2-[(1-methyl-2-oxo-4,5-dihydro-3H-1-benzazepin-7-yl)amino]pyrimidin-4-yl]amino]-N-prop-2-ynylbenzamide |
| SMILES | C#CCNC(=O)c1ccccc1Nc1nc(Nc2ccc3c(c2)CCCC(=O)N3C)ncc1Cl |
| InChI | InChI=1S/C25H23ClN6O2/c1-3-13-27-24(34)18-8-4-5-9-20(18)30-23-19(26)15-28-25(31-23)29-17-11-12-21-16(14-17)7-6-10-22(33)32(21)2/h1,4-5,8-9,11-12,14-15H,6-7,10,13H2,2H3,(H,27,34)(H2,28,29,30,31) |
| InChIKey | AWKVKBJHESFTRA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.95 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|