C33H28ClN3O — CID 53326634
1-[[3-[2-(4-chlorophenyl)ethynyl]phenyl]methyl]-3-propan-2-yl-1-[[3-(2-pyridin-3-ylethynyl)phenyl]methyl]urea (PubChem CID 53326634) has the molecular formula C33H28ClN3O and a molecular weight of 518.06 g/mol. Its IUPAC name is 1-[[3-[2-(4-chlorophenyl)ethynyl]phenyl]methyl]-3-propan-2-yl-1-[[3-(2-pyridin-3-ylethynyl)phenyl]methyl]urea.
| Compound Name | 1-[[3-[2-(4-chlorophenyl)ethynyl]phenyl]methyl]-3-propan-2-yl-1-[[3-(2-pyridin-3-ylethynyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 53326634 |
| Molecular Formula | C33H28ClN3O |
| Molecular Weight | 518.06 g/mol |
| Exact Mass | 517.19 |
| IUPAC Name | 1-[[3-[2-(4-chlorophenyl)ethynyl]phenyl]methyl]-3-propan-2-yl-1-[[3-(2-pyridin-3-ylethynyl)phenyl]methyl]urea |
| SMILES | CC(C)NC(=O)N(Cc1cccc(C#Cc2ccc(Cl)cc2)c1)Cc1cccc(C#Cc2cccnc2)c1 |
| InChI | InChI=1S/C33H28ClN3O/c1-25(2)36-33(38)37(24-31-9-4-7-28(21-31)13-14-29-10-5-19-35-22-29)23-30-8-3-6-27(20-30)12-11-26-15-17-32(34)18-16-26/h3-10,15-22,25H,23-24H2,1-2H3,(H,36,38) |
| InChIKey | CODRFCXJZNEDOM-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.06 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|